For research use only. Not for therapeutic Use.
Potassium pyruvate(Cat No.:L006957), is a chemical compound. It is the potassium salt of pyruvic acid, an important intermediate in cellular metabolism. Potassium pyruvate is used in various biological and biochemical studies. It is known for its potential antioxidant properties and is often used in cell culture media and research experiments related to cellular respiration, oxidative stress, and energy metabolism. Additionally, it is used as a supplement in sports nutrition due to its potential role in enhancing endurance and reducing fatigue.
Catalog Number | L006957 |
CAS Number | 4151-33-1 |
Molecular Formula | C3H3KO3 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | potassium;2-oxopropanoate |
InChI | InChI=1S/C3H4O3.K/c1-2(4)3(5)6;/h1H3,(H,5,6);/q;+1/p-1 |
InChIKey | JKVUQLWTIZFTMF-UHFFFAOYSA-M |
SMILES | CC(=O)C(=O)[O-].[K+] |