For research use only. Not for therapeutic Use.
PPDA (Cat No.: I010576), or p-Phenylenediamine, is an aromatic amine widely used in the chemical industry. It serves as a precursor in the production of polymers like Kevlar and is a key component in hair dyes, rubber antioxidants, and textile dyes. PPDA is known for its strong electron-donating properties, making it valuable in oxidative hair dye formulations. However, it can cause allergic reactions and skin sensitization in some individuals. Due to its reactivity, PPDA is also used in the synthesis of pharmaceuticals and high-performance materials.
| CAS Number | 684283-16-7 |
| Synonyms | (2S*,3R*)-1-(Phenanthren-2-carbonyl)piperazine-2,3-dicarboxylic acid |
| Molecular Formula | C21H18N2O5 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble to 50 mM in 2eq. NaOH and to 100 mM in DMSO |
| Storage | Store at +4C |
| IUPAC Name | (2S,3R)-1-(phenanthrene-2-carbonyl)piperazine-2,3-dicarboxylic acid |
| InChI | InChI=1S/C21H18N2O5/c24-19(23-10-9-22-17(20(25)26)18(23)21(27)28)14-7-8-16-13(11-14)6-5-12-3-1-2-4-15(12)16/h1-8,11,17-18,22H,9-10H2,(H,25,26)(H,27,28)/t17-,18+/m1/s1 |
| InChIKey | IWWXIZOMXGOTPP-MSOLQXFVSA-N |
| SMILES | C1CN(C(C(N1)C(=O)O)C(=O)O)C(=O)C2=CC3=C(C=C2)C4=CC=CC=C4C=C3 |
