For research use only. Not for therapeutic Use.
Subtype-selective NMDA receptor antagonist that preferentially binds to NR2C/NR2D-containing receptors (K<sub>i</sub> values are 0.096, 0.125, 0.31 and 0.55 <span class=/’symbol/’>μ</span>M for NR2C, NR2D, NR2B and NR2A subunits respectively).
| Catalog Number | I010576 |
| CAS Number | 684283-16-7 |
| Synonyms | (2S*,3R*)-1-(Phenanthren-2-carbonyl)piperazine-2,3-dicarboxylic acid |
| Molecular Formula | C21H18N2O5 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble to 50 mM in 2eq. NaOH and to 100 mM in DMSO |
| Storage | Store at +4C |
| IUPAC Name | (2S,3R)-1-(phenanthrene-2-carbonyl)piperazine-2,3-dicarboxylic acid |
| InChI | InChI=1S/C21H18N2O5/c24-19(23-10-9-22-17(20(25)26)18(23)21(27)28)14-7-8-16-13(11-14)6-5-12-3-1-2-4-15(12)16/h1-8,11,17-18,22H,9-10H2,(H,25,26)(H,27,28)/t17-,18+/m1/s1 |
| InChIKey | IWWXIZOMXGOTPP-MSOLQXFVSA-N |
| SMILES | C1CN(C(C(N1)C(=O)O)C(=O)O)C(=O)C2=CC3=C(C=C2)C4=CC=CC=C4C=C3 |
