For research use only. Not for therapeutic Use.
PqsR/LasR-IN-3（Cat No.:I043553）is a potent small molecule inhibitor targeting the PqsR and LasR receptors involved in bacterial quorum sensing. These receptors play a critical role in regulating the virulence and biofilm formation of Pseudomonas aeruginosa, a pathogen associated with chronic infections. By blocking the interaction between these receptors and their signaling molecules, PqsR/LasR-IN-3 disrupts bacterial communication, preventing the expression of harmful genes and reducing biofilm formation. This inhibition has significant potential in developing novel therapeutic strategies to treat antibiotic-resistant infections, offering a promising alternative to traditional antibiotics.
| CAS Number | 2581109-51-3 |
| Synonyms | 4-(benzenesulfonyl)-N-(2-oxooxolan-3-yl)butanamide |
| Molecular Formula | C14H17NO5S |
| Purity | ≥95% |
| IUPAC Name | 4-(benzenesulfonyl)-N-(2-oxooxolan-3-yl)butanamide |
| InChI | InChI=1S/C14H17NO5S/c16-13(15-12-8-9-20-14(12)17)7-4-10-21(18,19)11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,15,16) |
| InChIKey | IMWIYQHJNAXHKW-UHFFFAOYSA-N |
| SMILES | C1COC(=O)C1NC(=O)CCCS(=O)(=O)C2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
