For research use only. Not for therapeutic Use.
Praziquantel（Cat No.:A000951） is an anthelmintic medication used to treat parasitic worm infections, particularly schistosomiasis and liver flukes. It works by increasing the permeability of the parasite’s cell membranes to calcium ions, causing paralysis and death of the worms. Praziquantel is effective against a broad range of trematodes and cestodes, making it a versatile treatment option. It is well-tolerated, with mild side effects such as dizziness and gastrointestinal discomfort. Its oral administration and rapid action contribute to its widespread use in both human and veterinary medicine for managing parasitic infections.
| Catalog Number | A000951 |
| CAS Number | 55268-74-1 |
| Synonyms | 55268-74-1; Droncit; Biltricide; Pyquiton; Cesol |
| Molecular Formula | C19H24N2O2 |
| Purity | ≥95% |
| Target | Antibiotic |
| Solubility | >14.4mg/mL in DMSO |
| Storage | -20°C |
| IUPAC Name | 2-(cyclohexanecarbonyl)-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one |
| InChI | InChI=1S/C19H24N2O2/c22-18-13-20(19(23)15-7-2-1-3-8-15)12-17-16-9-5-4-6-14(16)10-11-21(17)18/h4-6,9,15,17H,1-3,7-8,10-13H2 |
| InChIKey | FSVJFNAIGNNGKK-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(=O)N2CC3C4=CC=CC=C4CCN3C(=O)C2 |
