For research use only. Not for therapeutic Use.
Pregnenolone-d4(CAT: R020189) is a deuterated form of pregnenolone, a naturally occurring steroid hormone. Its mode of action involves being a labeled version of pregnenolone, where four hydrogen atoms are replaced with deuterium atoms. This compound is used as an internal standard in analytical chemistry and pharmacokinetic studies. Deuterated compounds like Pregnenolone-d4 are valuable tools in drug metabolism and pharmacology research, as they allow for accurate quantification and determination of drug levels in biological samples.
CAS Number | 61574-54-7 |
Synonyms | (3β)-3-Hydroxy-pregn-5-en-20-one-d4; (3β)-3-Hydroxypregn-5-en-20-one-d4; 5-Pregnenolone-d4; Arthenolone-d4; Bina-Skin-d4; Enelone-d4; NSC 1616-d4; Pregnolon-d4; Prenolon-d4; Regnosone-d4; Skinostelon-d4; |
Molecular Formula | C21H32O2 |
Purity | ≥95% |
Target | Membrane Transporter/Ion Channel |
Storage | -20°C |
IUPAC Name | 2,2,2-trideuterio-1-[(3S,8S,9S,10R,13S,14S,17S)-17-deuterio-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
InChI | InChI=1S/C21H32O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h4,15-19,23H,5-12H2,1-3H3/t15-,16-,17+,18-,19-,20-,21+/m0/s1/i1D3,17D |
InChIKey | ORNBQBCIOKFOEO-QVFJSNPXSA-N |
SMILES | [2H][C@@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)C(=O)C([2H])([2H])[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |