For research use only, not for therapeutic use.
Presatovir （Cat No.:I001364） is an antiviral drug that targets the respiratory syncytial virus (RSV), a common virus that causes respiratory infections. It works by inhibiting the fusion of RSV with the host cell, thereby preventing the virus from replicating and causing further damage. Presatovir has shown promising results in preclinical and clinical studies and is currently being evaluated for its efficacy and safety in treating RSV infections.
| Catalog Number | I001364 |
| CAS Number | 1353625-73-6 |
| Molecular Formula | C24H30ClN7O3S |
| Purity | ≥95% |
| Target | RSV |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | N-[2-[(2S)-2-[5-[(3S)-3-aminopyrrolidin-1-yl]-6-methylpyrazolo[1,5-a]pyrimidin-2-yl]piperidine-1-carbonyl]-4-chlorophenyl]methanesulfonamide |
| InChI | InChI=1S/C24H30ClN7O3S/c1-15-13-32-22(27-23(15)30-10-8-17(26)14-30)12-20(28-32)21-5-3-4-9-31(21)24(33)18-11-16(25)6-7-19(18)29-36(2,34)35/h6-7,11-13,17,21,29H,3-5,8-10,14,26H2,1-2H3/t17-,21-/m0/s1 |
| InChIKey | GOFXWTVKPWJNGD-UWJYYQICSA-N |
| SMILES | CC1=CN2C(=CC(=N2)C3CCCCN3C(=O)C4=C(C=CC(=C4)Cl)NS(=O)(=O)C)N=C1N5CCC(C5)N |
| Reference | <p style=/line-height:25px/> </p> |
