For research use only. Not for therapeutic Use.
Pridinol Methanesulfonate Salt (Cat. No: R000381) is a small molecule inhibitor, which has been proven to be a central anticholinergic drug with skeletal muscle relaxation and has a significant relaxation effect on muscle spasms.
| Catalog Number | R000381 |
| CAS Number | 6856-31-1 |
| Synonyms | α,α-Diphenyl-1-piperidinepropanol Methanesulfonate; 3-Piperidino-1,1-diphenyl-1-propanol Methanesulfonate; Konlax; Loxeen; Lyseen; Mitanoline; Pridinol Mesylate; Pridinol Methanesulfonate |
| Molecular Formula | C21H29NO4S |
| Purity | ≥95% |
| Target | Cholinesterase (ChE) |
| Storage | Store at RT |
| IUPAC Name | 1,1-diphenyl-3-piperidin-1-ylpropan-1-ol;methanesulfonic acid |
| InChI | InChI=1S/C20H25NO.CH4O3S/c22-20(18-10-4-1-5-11-18,19-12-6-2-7-13-19)14-17-21-15-8-3-9-16-21;1-5(2,3)4/h1-2,4-7,10-13,22H,3,8-9,14-17H2;1H3,(H,2,3,4) |
| InChIKey | VNJHUUNVDMYCRH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1CCN(CC1)CCC(C2=CC=CC=C2)(C3=CC=CC=C3)O |
