For research use only. Not for therapeutic Use.
Primaquine（Cat No.:L047423）is an antimalarial medication primarily used to target the liver stages of Plasmodium parasites, including Plasmodium vivax and Plasmodium ovale. Unlike other antimalarials, it is effective in eliminating dormant liver forms (hypnozoites), preventing relapse in these malaria types. Primaquine is also used in malaria transmission control due to its ability to kill gametocytes, reducing spread by mosquitoes. It is typically administered with other antimalarials to ensure complete parasite clearance. Primaquine’s unique action on latent and gametocyte stages makes it essential in malaria eradication efforts.
| Catalog Number | L047423 |
| CAS Number | 90-34-6 |
| Molecular Formula | C15H21N3O |
| Purity | ≥95% |
| IUPAC Name | 4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine |
| InChI | InChI=1S/C15H21N3O/c1-11(5-3-7-16)18-14-10-13(19-2)9-12-6-4-8-17-15(12)14/h4,6,8-11,18H,3,5,7,16H2,1-2H3 |
| InChIKey | INDBQLZJXZLFIT-UHFFFAOYSA-N |
| SMILES | CC(CCCN)NC1=C2C(=CC(=C1)OC)C=CC=N2 |
