For research use only. Not for therapeutic Use.
Prinaberel(CAT: I003918) (also known as ERB-041) is a highly selective agonist of estrogen receptor beta (ERβ). By selectively activating ERβ, Prinaberel modulates gene expression involved in regulating inflammation, cell proliferation, and differentiation while minimizing the side effects associated with estrogen receptor alpha (ERα) activation. This selective mechanism makes Prinaberel a promising therapeutic candidate in the treatment of inflammatory diseases such as rheumatoid arthritis, as well as in oncology for hormone-responsive cancers. Prinaberel is also being explored in neuroprotection and metabolic disease research due to ERβ’s role in these physiological processes.
| Catalog Number | I003918 |
| CAS Number | 524684-52-4 |
| Synonyms | (Z)-2-fluoro-4-(5-hydroxy-7-vinylbenzo[d]oxazol-2(3H)-ylidene)cyclohexa-2,5-dienone |
| Molecular Formula | C15H10FNO3 |
| Purity | ≥95% |
| Target | Stem Cell/Wnt |
| Solubility | DMSO: ≥ 40 mg/mL |
| Storage | Store at -20C |
| IUPAC Name | 7-ethenyl-2-(3-fluoro-4-hydroxyphenyl)-1,3-benzoxazol-5-ol |
| InChI | InChI=1S/C15H10FNO3/c1-2-8-5-10(18)7-12-14(8)20-15(17-12)9-3-4-13(19)11(16)6-9/h2-7,18-19H,1H2 |
| InChIKey | MQIMZDXIAHJKQP-UHFFFAOYSA-N |
| SMILES | C=CC1=C2C(=CC(=C1)O)N=C(O2)C3=CC(=C(C=C3)O)F |
