For research use only. Not for therapeutic Use.
Pristinamycin IA（Cat No.:I000037）is a potent antibiotic used primarily for the treatment of Gram-positive bacterial infections. It belongs to the pristinamycin family of streptogramin antibiotics and acts by inhibiting protein synthesis in bacteria. Pristinamycin IA specifically targets bacterial ribosomes, binding to the 50S subunit to prevent the elongation of the polypeptide chain, thereby stopping bacterial growth. It is particularly effective against strains resistant to other antibiotics, such as methicillin-resistant Staphylococcus aureus (MRSA). This compound is often used in combination with other antibiotics for synergistic effects.
| Catalog Number | I000037 |
| CAS Number | 3131-03-1 |
| Molecular Formula | C45H54N8O10 |
| Purity | ≥95% |
| Target | Bacterial |
| Solubility | DMSO ≥ 28 mg/mL |
| Storage | -20°C |
| IUPAC Name | N-[3-[[4-(dimethylamino)phenyl]methyl]-12-ethyl-4,16-dimethyl-2,5,11,14,18,21,24-heptaoxo-19-phenyl-17-oxa-1,4,10,13,20-pentazatricyclo[20.4.0.06,10]hexacosan-15-yl]-3-hydroxypyridine-2-carboxamide |
| InChI | InChI=1S/C45H54N8O10/c1-6-31-42(59)52-22-11-14-32(52)43(60)51(5)34(24-27-16-18-29(19-17-27)50(3)4)44(61)53-23-20-30(54)25-33(53)39(56)49-37(28-12-8-7-9-13-28)45(62)63-26(2)36(40(57)47-31)48-41(58)38-35(55)15-10-21-46-38/h7-10,12-13,15-19,21,26,31-34,36-37,55H,6,11,14,20,22-25H2,1-5H3,(H,47,57)(H,48,58)(H,49,56) |
| InChIKey | YGXCETJZBDTKRY-UHFFFAOYSA-N |
| SMILES | CCC1C(=O)N2CCCC2C(=O)N(C(C(=O)N3CCC(=O)CC3C(=O)NC(C(=O)OC(C(C(=O)N1)NC(=O)C4=C(C=CC=N4)O)C)C5=CC=CC=C5)CC6=CC=C(C=C6)N(C)C)C |
| Reference | <p style=/line-height:25px/> </p> |
