For research use only. Not for therapeutic Use.
PRL-8-53（Cat No.:M144277）, is a synthetic nootropic compound known for its potential cognitive-enhancing properties. Developed in the 1970s, its exact mechanism of action is not fully understood, but it is believed to modulate cholinergic and glutamatergic neurotransmitter systems in the brain. PRL-8-53 has been studied for its potential to improve memory and cognitive function, and some anecdotal reports suggest it may enhance learning and information retention.
| Catalog Number | M144277 |
| CAS Number | 51352-87-5 |
| Synonyms | 51352-87-5; Methyl 3-(2-(benzyl(methyl)amino)ethyl)benzoate hydrochloride; Prl-8-53; |
| Molecular Formula | C18H22ClNO2 |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | methyl 3-[2-[benzyl(methyl)amino]ethyl]benzoate;hydrochloride |
| InChI | InChI=1S/C18H21NO2.ClH/c1-19(14-16-7-4-3-5-8-16)12-11-15-9-6-10-17(13-15)18(20)21-2;/h3-10,13H,11-12,14H2,1-2H3;1H |
| InChIKey | HLBBSWSJLPLPRU-UHFFFAOYSA-N |
| SMILES | CN(CCC1=CC=CC(=C1)C(=O)OC)CC2=CC=CC=C2.Cl |
