For research use only. Not for therapeutic Use.
PRMT5-IN-1 hydrochloride（Cat No.:I042849）is a small molecule inhibitor designed to target and inhibit Protein Arginine Methyltransferase 5 (PRMT5), an enzyme involved in the methylation of arginine residues on histones and non-histone proteins. PRMT5 plays a critical role in regulating gene expression, cell cycle progression, and RNA splicing. Dysregulated PRMT5 activity is implicated in various cancers and other diseases. By inhibiting PRMT5, PRMT5-IN-1 hydrochloride aims to disrupt these cellular processes, making it a potential therapeutic candidate for cancer treatment and other conditions associated with abnormal PRMT5 activity. It is currently undergoing preclinical evaluations.
| Synonyms | (2R,3S,4R,5R)-2-[(R)-(4-chlorophenyl)-hydroxymethyl]-5-(5-hydroxy-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraen-10-yl)oxolane-3,4-diol;hydrochloride |
| Molecular Formula | C19H20Cl2N4O5 |
| Purity | ≥95% |
| IUPAC Name | (2R,3S,4R,5R)-2-[(R)-(4-chlorophenyl)-hydroxymethyl]-5-(5-hydroxy-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraen-10-yl)oxolane-3,4-diol;hydrochloride |
| InChI | InChI=1S/C19H19ClN4O5.ClH/c20-10-3-1-9(2-4-10)13(26)16-14(27)15(28)19(29-16)23-6-5-11-17-21-7-12(25)24(17)8-22-18(11)23;/h1-6,8,12-16,19,25-28H,7H2;1H/t12?,13-,14+,15-,16-,19-;/m1./s1 |
| InChIKey | OREUSXWUJCVJDC-DEPNVVRZSA-N |
| SMILES | C1C(N2C=NC3=C(C2=N1)C=CN3[C@H]4[C@@H]([C@@H]([C@H](O4)[C@@H](C5=CC=C(C=C5)Cl)O)O)O)O.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
