For research use only. Not for therapeutic Use.
PRMT5-IN-31(CAT: I040990) is a potent and selective PRMT5 (Protein Arginine Methyltransferase 5) inhibitor, designed for epigenetics and cancer research. PRMT5 plays a critical role in gene regulation, RNA processing, and tumorigenesis, making it a promising target for cancer, neurological disorders, and immune-related diseases. PRMT5-IN-31 effectively inhibits PRMT5-mediated arginine methylation, offering a valuable tool for studying epigenetic modifications and potential therapeutic strategies. Optimized for biochemical, cellular, and preclinical studies, it is ideal for investigating PRMT5-dependent pathways. For research use only; not for human or clinical applications.
| Catalog Number | I040990 |
| Synonyms | (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-methoxyindol-1-yl)propan-2-ol |
| Molecular Formula | C21H24N2O2 |
| Purity | ≥95% |
| IUPAC Name | (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-methoxyindol-1-yl)propan-2-ol |
| InChI | InChI=1S/C21H24N2O2/c1-25-20-6-7-21-17(12-20)9-11-23(21)15-19(24)14-22-10-8-16-4-2-3-5-18(16)13-22/h2-7,9,11-12,19,24H,8,10,13-15H2,1H3/t19-/m1/s1 |
| InChIKey | MBVMUGJPXQTTTC-LJQANCHMSA-N |
| SMILES | COC1=CC2=C(C=C1)N(C=C2)CC(CN3CCC4=CC=CC=C4C3)O |
