For research use only. Not for therapeutic Use.
PRMT5:MEP50 PPI (Cat No.:I042707) refers to the complex formed between Protein Arginine Methyltransferase 5 (PRMT5) and MEP50 (also known as WDR77), a cofactor required for PRMT5’s enzymatic activity. This interaction is crucial for regulating gene expression and various cellular processes, such as cell cycle progression and differentiation. PRMT5 catalyzes the symmetric dimethylation of arginine residues in target proteins, which influences RNA processing, chromatin remodeling, and signal transduction. Targeting the PRMT5:MEP50 PPI is being explored as a therapeutic strategy in cancers and other diseases involving dysregulated arginine methylation.
CAS Number | 3031536-71-4 |
Synonyms | N’-[3-[(3-ethyl-5-methyl-1,2-oxazol-4-yl)methoxy]benzoyl]quinoline-2-carbohydrazide |
Molecular Formula | C24H22N4O4 |
Purity | ≥95% |
IUPAC Name | N'-[3-[(3-ethyl-5-methyl-1,2-oxazol-4-yl)methoxy]benzoyl]quinoline-2-carbohydrazide |
InChI | InChI=1S/C24H22N4O4/c1-3-20-19(15(2)32-28-20)14-31-18-9-6-8-17(13-18)23(29)26-27-24(30)22-12-11-16-7-4-5-10-21(16)25-22/h4-13H,3,14H2,1-2H3,(H,26,29)(H,27,30) |
InChIKey | SJWRHQSLYNANNC-UHFFFAOYSA-N |
SMILES | CCC1=NOC(=C1COC2=CC=CC(=C2)C(=O)NNC(=O)C3=NC4=CC=CC=C4C=C3)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |