For research use only. Not for therapeutic Use.
Pro-Asp(Cat No.:L007013), also known as poly aspartic acid, is a dipeptide composed of the amino acids proline (Pro) and aspartic acid (Asp). Its chemical structure is C10H16N2O5. Pro-Asp is significant in biological processes, being involved in protein synthesis, enzyme reactions, and cellular signaling pathways. Proline, a non-essential amino acid, plays a role in protein structure and stability, while aspartic acid, an essential amino acid, contributes to neurotransmitter function and metabolic processes.
Catalog Number | L007013 |
CAS Number | 85227-98-1 |
Molecular Formula | C9H14N2O5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]butanedioic acid |
InChI | InChI=1S/C9H14N2O5/c12-7(13)4-6(9(15)16)11-8(14)5-2-1-3-10-5/h5-6,10H,1-4H2,(H,11,14)(H,12,13)(H,15,16)/t5-,6-/m0/s1 |
InChIKey | GLEOIKLQBZNKJZ-WDSKDSINSA-N |
SMILES | C1CC(NC1)C(=O)NC(CC(=O)O)C(=O)O |