For research use only. Not for therapeutic Use.
Proadifen hydrochloride（Cat No.:I004362）, also known as SKF-525A, is a non-selective inhibitor of cytochrome P450 enzymes, which are involved in the metabolism of various drugs and endogenous compounds. By inhibiting these enzymes, proadifen hydrochloride prevents the oxidation of substrates, making it a valuable tool in pharmacological research to study drug-drug interactions and metabolic pathways. It has been used in studies related to drug metabolism, enzyme inhibition, and the modulation of detoxification processes. Its ability to inhibit multiple P450 isoforms has broad implications in toxicology and pharmacokinetics research.
| Catalog Number | I004362 |
| CAS Number | 62-68-0 |
| Synonyms | α-phenyl-α-propyl-benzeneacetic acid, 2-(diethylamino)ethyl ester, monohydrochloride |
| Molecular Formula | C23H31NO2 • HCl |
| Purity | ≥95% |
| Target | Cytochrome P450 |
| Solubility | DMSO: ＞ 40 mg/mL |
| Storage | Store at -20°C |
| IC50 | 19μM |
| IUPAC Name | 2-(diethylamino)ethyl 2,2-diphenylpentanoate;hydrochloride |
| InChI | InChI=1S/C23H31NO2.ClH/c1-4-17-23(20-13-9-7-10-14-20,21-15-11-8-12-16-21)22(25)26-19-18-24(5-2)6-3;/h7-16H,4-6,17-19H2,1-3H3;1H |
| InChIKey | FHIKZROVIDCMJA-UHFFFAOYSA-N |
| SMILES | CCCC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)OCCN(CC)CC.Cl |
| Reference | <p style=/line-height:25px/> |
