For research use only. Not for therapeutic Use.
Procainamide hydrochloride (Cat No.: I004324) is a Class 1a antiarrhythmic medication used to treat irregular heart rhythms, such as atrial fibrillation and ventricular arrhythmias. It works by blocking sodium channels, which slows the electrical impulses in the heart and helps restore normal rhythm. Procainamide is typically administered orally or intravenously, depending on the severity of the condition. Common side effects include nausea, headache, and dizziness, while more serious side effects can include lupus-like symptoms and blood dyscrasias. Regular monitoring is recommended during treatment.
| Catalog Number | I004324 |
| CAS Number | 614-39-1 |
| Synonyms | 4-amino-N-[2-(diethylamino)ethyl]benzamide;hydrochloride |
| Molecular Formula | C13H22ClN3O |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | H2O: 50 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | 4-amino-N-[2-(diethylamino)ethyl]benzamide;hydrochloride |
| InChI | 1S/C13H21N3O.ClH/c1-3-16(4-2)10-9-15-13(17)11-5-7-12(14)8-6-11;/h5-8H,3-4,9-10,14H2,1-2H3,(H,15,17);1H |
| InChIKey | ABTXGJFUQRCPNH-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)C1=CC=C(C=C1)N.Cl |
