For research use only. Not for therapeutic Use.
Procainamide is a specific and potent inhibitor of DNA methyltransferase 1 (DNMT1). Procainamide is a Class 1A antiarrhythmic agent. Procainamide has the potential for the research of cancer and arrhythmias[1][2].
| Catalog Number | I035029 |
| CAS Number | 51-06-9 |
| Synonyms | 4-amino-N-[2-(diethylamino)ethyl]benzamide |
| Molecular Formula | C13H21N3O |
| Purity | ≥95% |
| InChI | InChI=1S/C13H21N3O/c1-3-16(4-2)10-9-15-13(17)11-5-7-12(14)8-6-11/h5-8H,3-4,9-10,14H2,1-2H3,(H,15,17) |
| InChIKey | REQCZEXYDRLIBE-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)C1=CC=C(C=C1)N |
| Reference | [1]. Lee BH, et al. Procainamide is a specific inhibitor of DNA methyltransferase 1. J Biol Chem. 2005;280(49):40749-40756. [2]. Pritchard B, et al. Procainamide. [Updated 2021 Aug 8]. In: StatPearls [Internet]. Treasure Island (FL): StatPearls Publishing; 2022 Jan-. |
