For research use only. Not for therapeutic Use.
Procodazole(Cat No.:I002772), also known as Propazol or 2-Benzimidazole propionic acid, 3-(1H-benzimidazole-2) propanoic acid, is a compound that can act as a potentiator with nonspecific active immune protection against viral and bacterial infections. It enhances the immune response, making it more effective in fighting off infections caused by pathogens. Procodazole may be utilized in various applications where boosting the immune system’s activity is desired, such as in the development of immunomodulatory therapies or as an additive in vaccines to enhance their efficacy against infectious diseases.
CAS Number | 23249-97-0 |
Molecular Formula | C10H10N2O2 |
Purity | ≥95% |
Target | Bacterial |
Solubility | 10 mM in H2O |
Storage | 2-8°C |
IUPAC Name | 3-(1H-benzimidazol-2-yl)propanoic acid |
InChI | InChI=1S/C10H10N2O2/c13-10(14)6-5-9-11-7-3-1-2-4-8(7)12-9/h1-4H,5-6H2,(H,11,12)(H,13,14) |
InChIKey | XYWJNTOURDMTPI-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)NC(=N2)CCC(=O)O |
Reference | <p style=/line-height:25px/> |