For research use only. Not for therapeutic Use.
Procyanidin B1(Cat No.:I002567)is a type of flavonoid, specifically a proanthocyanidin, found in various fruits, vegetables, and plants, particularly in grapes, apples, and cacao. It is known for its antioxidant properties, helping to neutralize free radicals and reduce oxidative stress in the body. Procyanidin B1 has been studied for its potential cardiovascular benefits, including improving blood flow, reducing inflammation, and supporting heart health. Additionally, it may have anticancer, anti-inflammatory, and neuroprotective effects. While promising, more research is needed to fully understand its mechanisms and therapeutic applications in human health.
CAS Number | 20315-25-7 |
Synonyms | (−)-Epicatechin-(4β-8)-(+)-catechin;Proanthocyanidin B1;Procyanidol B1 |
Molecular Formula | C30H26O12 |
Purity | ≥95% |
Target | Toll-like Receptor (TLR) |
Solubility | 10 mM in DMSO |
Storage | -20°C |
IUPAC Name | (2R,3S)-2-(3,4-dihydroxyphenyl)-8-[(2R,3R,4R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
InChI | InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26+,27+,28+,29+/m0/s1 |
InChIKey | XFZJEEAOWLFHDH-UKWJTHFESA-N |
SMILES | C1[C@@H]([C@H](OC2=C1C(=CC(=C2[C@@H]3[C@H]([C@H](OC4=CC(=CC(=C34)O)O)C5=CC(=C(C=C5)O)O)O)O)O)C6=CC(=C(C=C6)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |