For research use only. Not for therapeutic Use.
Proglumide sodium salt (Cat.No:I010415) is a compound known for its cholecystokinin (CCK) antagonist properties. It inhibits CCK receptors and has been investigated for its potential use in the treatment of various gastrointestinal disorders, including acid-related diseases and functional dyspepsia. Proglumide sodium salt may help regulate gastric acid secretion and improve digestive symptoms.
| Catalog Number | I010415 |
| CAS Number | 99247-33-3 |
| Synonyms | 4-(Benzoylamino)-5-(dipropylamino)-5-oxopentanoic acid sodium salt |
| Molecular Formula | C18H25N2NaO4 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble to 100 mM in water |
| Storage | Desiccate at RT |
| IUPAC Name | sodium;4-benzamido-5-(dipropylamino)-5-oxopentanoate |
| InChI | InChI=1S/C18H26N2O4.Na/c1-3-12-20(13-4-2)18(24)15(10-11-16(21)22)19-17(23)14-8-6-5-7-9-14;/h5-9,15H,3-4,10-13H2,1-2H3,(H,19,23)(H,21,22);/q;+1/p-1 |
| InChIKey | UFMWGCINVOIJSO-UHFFFAOYSA-M |
| SMILES | CCCN(CCC)C(=O)C(CCC(=O)[O-])NC(=O)C1=CC=CC=C1.[Na+] |
