For research use only. Not for therapeutic Use.
Prohydrojasmon(Cat No.:H000071), is a synthetic compound used in agriculture as a plant growth regulator and stress response elicitor. It is a derivative of jasmonic acid, a natural plant hormone involved in various physiological processes, including plant defense mechanisms. Prohydrojasmon is applied to crops to induce stress responses that can enhance resistance to pests, pathogens, and environmental stressors. It can also promote certain aspects of plant growth, such as root development and fruit ripening.
Catalog Number | H000071 |
CAS Number | 158474-72-7 |
Molecular Formula | C15H26O3 |
Purity | ≥95% |
Storage | 0-6°C |
IUPAC Name | propyl 2-(3-oxo-2-pentylcyclopentyl)acetate |
InChI | InChI=1S/C15H26O3/c1-3-5-6-7-13-12(8-9-14(13)16)11-15(17)18-10-4-2/h12-13H,3-11H2,1-2H3 |
InChIKey | IPDFPNNPBMREIF-UHFFFAOYSA-N |
SMILES | CCCCCC1C(CCC1=O)CC(=O)OCCC |