For research use only. Not for therapeutic Use.
Prolintane Hydrochloride is a stimulant and psychoactive compound originally developed for its cognitive-enhancing and energizing effects. Structurally related to amphetamines, it functions by increasing the levels of dopamine and norepinephrine in the brain, leading to heightened alertness, improved focus, and reduced fatigue. Prolintane Hydrochloride has been used clinically to treat conditions like narcolepsy, chronic fatigue, and attention disorders. However, its potential for abuse and dependency has led to its control in many countries. It remains of interest in research for its effects on cognition and neurochemistry.
| Catalog Number | R054409 |
| CAS Number | 1211-28-5 |
| Synonyms | NSC 169914;SP 732 |
| Molecular Formula | C15H24ClN |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-(1-phenylpentan-2-yl)pyrrolidine;hydrochloride |
| InChI | InChI=1S/C15H23N.ClH/c1-2-8-15(16-11-6-7-12-16)13-14-9-4-3-5-10-14;/h3-5,9-10,15H,2,6-8,11-13H2,1H3;1H |
| InChIKey | FKOFBBOQSMUYHD-UHFFFAOYSA-N |
| SMILES | CCCC(CC1=CC=CC=C1)N2CCCC2.Cl |
