For research use only. Not for therapeutic Use.
Promazine (Romtiazin, Sinophenin) is an antagonist at types 1, 2, and 4 dopamine receptors, 5-HT receptor types 2A and 2C, muscarinic receptors 1 through 5, alpha(1)-receptors, and histamine H1-receptors with antipsychotic effects.
| Catalog Number | I003956 |
| CAS Number | 53-60-1 |
| Molecular Formula | C17H20N2S.HCl |
| Purity | ≥95% |
| Storage | 3 years -20°C powder |
| SMILES | CN(C)CCCN1C2=CC=CC=C2SC3=CC=CC=C31.Cl |
