For research use only. Not for therapeutic Use.
Pronethalol hydrochloride（Cat No.:I010308）is a non-selective beta-blocker that was initially developed for the treatment of hypertension and arrhythmias. It works by blocking beta-adrenergic receptors in the heart and blood vessels, leading to a reduction in heart rate, blood pressure, and the workload on the heart. However, it was withdrawn from clinical use due to concerns about its potential carcinogenicity. Despite this, pronethalol’s development led to the creation of other, safer beta-blockers that are widely used today, such as propranolol. Pronethalol is primarily used in research to study beta-receptor blocking mechanisms.
| Catalog Number | I010308 |
| CAS Number | 51-02-5 |
| Synonyms | Alternative Name: ICI-38174 |
| Molecular Formula | C15H20ClNO |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble to 100 mM in water |
| Storage | Store at RT |
| IUPAC Name | 1-naphthalen-2-yl-2-(propan-2-ylamino)ethanol;hydrochloride |
| InChI | InChI=1S/C15H19NO.ClH/c1-11(2)16-10-15(17)14-8-7-12-5-3-4-6-13(12)9-14;/h3-9,11,15-17H,10H2,1-2H3;1H |
| InChIKey | QONLGXRPRAIDGI-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(C1=CC2=CC=CC=C2C=C1)O.Cl |
