For research use only. Not for therapeutic Use.
Propanoic acid, 2-[(ethoxythioxomethyl)thio]-, ethyl ester (Cat.No:L004173) is a significant chemical compound with versatile applications. Its unique structure, featuring an ethoxythioxomethylthio group, imparts specialized reactivity. This compound serves as a valuable intermediate in the synthesis of specialized organic molecules with diverse industrial and pharmaceutical applications.
CAS Number | 73232-07-2 |
Molecular Formula | C8H14O3S2 |
Purity | ≥95% |
IUPAC Name | ethyl 2-ethoxycarbothioylsulfanylpropanoate |
InChI | InChI=1S/C8H14O3S2/c1-4-10-7(9)6(3)13-8(12)11-5-2/h6H,4-5H2,1-3H3 |
InChIKey | GZRNLTZJAIIDLJ-UHFFFAOYSA-N |
SMILES | CCOC(=O)C(C)SC(=S)OCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |