For research use only. Not for therapeutic Use.
Proparacaine Hydrochloride (Cat No.: A001051) is the hydrochloride salt form of proparacaine, a benzoic acid derivative with local anesthetic property. It is used as a topical ophthalmic anesthetic. Proparacaine hydrochloride stabilizes the neuronal membrane by binding to and inhibiting voltage-gated sodium channels, thereby inhibiting sodium ion influx required for the initiation and conduction of impulses within the neuronal cell, and resulting in a loss of sensation.
| Catalog Number | A001051 |
| CAS Number | 5875-06-9 |
| Synonyms | 5875-06-9; Proparacaine Hcl; Proxymetacaine hydrochloride; Ophthain; 2-(Diethylamino)ethyl 3-Amino-4-propoxybenzoate Hydrochloride |
| Molecular Formula | C16H27ClN2O3 |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | >14.9mg/mL in DMSO |
| Storage | -20°C |
| IUPAC Name | 2-(diethylamino)ethyl 3-amino-4-propoxybenzoate;hydrochloride |
| InChI | 1S/C16H26N2O3.ClH/c1-4-10-20-15-8-7-13(12-14(15)17)16(19)21-11-9-18(5-2)6-3;/h7-8,12H,4-6,9-11,17H2,1-3H3;1H |
| InChIKey | BFUUJUGQJUTPAF-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=C(C=C1)C(=O)OCCN(CC)CC)N.Cl |
