Propargyl acetate(Cat No.:L006956), is an organic compound. It is a clear, colorless liquid with a pungent odor, used in organic synthesis as a versatile building block. The presence of both a propargyl group (–C≡CH) and an acetate group (–COOCH3) makes it valuable in various chemical reactions. Propargyl acetate is used to prepare pharmaceuticals, agrochemicals, and specialty chemicals. Its acetylenic functionality provides opportunities for click chemistry and other transformations, enabling the synthesis of complex organic molecules.
Catalog Number | L006956 |
CAS Number | 627-09-8 |
Molecular Formula | C5H6O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | prop-2-ynyl acetate |
InChI | InChI=1S/C5H6O2/c1-3-4-7-5(2)6/h1H,4H2,2H3 |
InChIKey | RIZZXCJMFIGMON-UHFFFAOYSA-N |
SMILES | CC(=O)OCC#C |