For research use only. Not for therapeutic Use.
Propargyl-PEG2-acid(Cat No.:I014597)is a chemical compound consisting of a propargyl group, a polyethylene glycol (PEG) spacer of two ethylene glycol units, and a carboxylic acid group. It is often used in drug delivery and biomedical research, as the PEG linker enhances solubility, stability, and bioavailability. The propargyl group allows for click chemistry reactions, enabling attachment to various molecules or surfaces for targeted therapeutic applications. Propargyl-PEG2-acid has potential in designing conjugates for cancer therapy, gene delivery, and other applications where controlled release and precise targeting are important for therapeutic efficacy.
CAS Number | 1859379-85-3 |
Synonyms | Propargyl-PEG2-acid;3-(2-(prop-2-yn-1-yloxy)ethoxy)propanoic acid |
Molecular Formula | C8H12O4 |
Purity | ≥95% |
Target | PROTAC |
Solubility | Soluble in DMSO |
IUPAC Name | 3-(2-prop-2-ynoxyethoxy)propanoic acid |
InChI | InChI=1S/C8H12O4/c1-2-4-11-6-7-12-5-3-8(9)10/h1H,3-7H2,(H,9,10) |
InChIKey | NNWHATPXNWOQKD-UHFFFAOYSA-N |
SMILES | C#CCOCCOCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |