For research use only. Not for therapeutic Use.
Propargyl-PEG5-t-butyl ester(Cat No.:I014633)is a compound that consists of a propargyl group (a triple-bonded alkyne), a polyethylene glycol (PEG) chain with five ethylene glycol units, and a t-butyl ester group. The PEG component is commonly used to enhance solubility and bioavailability in various applications, including drug delivery systems. The propargyl group enables the compound to participate in click chemistry reactions, a useful tool in chemical biology and drug design. This compound is often used in the synthesis of drug conjugates and nanomedicines, offering the potential for targeted therapies and controlled release applications.
CAS Number | 1245823-50-0 |
Synonyms | Propargyl-PEG5-t-butyl ester;Propargyl-PEG5-t-butyl ester |
Molecular Formula | C18H32O7 |
Purity | ≥95% |
Target | PROTAC |
Solubility | Soluble in DMSO |
IUPAC Name | tert-butyl 3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoate |
InChI | InChI=1S/C18H32O7/c1-5-7-20-9-11-22-13-15-24-16-14-23-12-10-21-8-6-17(19)25-18(2,3)4/h1H,6-16H2,2-4H3 |
InChIKey | YPLMNICQRHSVNT-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCC#C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |