For research use only. Not for therapeutic Use.
Propentofylline (Cat.No:R005053) is a xanthine derivative that combines the properties of caffeine and theophylline. It has anti-inflammatory and neuroprotective effects, making it a potential treatment for neurodegenerative disorders like Alzheimer’s and Parkinson’s disease. Additionally, it may enhance cognitive function and improve blood flow in the brain.
CAS Number | 55242-55-2 |
Synonyms | 3,7-Dihydro-3-methyl-1-(5-oxohexyl)-7-propyl-1H-purine-2,6-dione; HWA-285; Albert-285; HOE-285; Hextol; Karsivan; |
Molecular Formula | C15H22N4O3 |
Purity | ≥95% |
Target | Phosphodiesterase (PDE) |
Storage | 4°C |
IUPAC Name | 3-methyl-1-(5-oxohexyl)-7-propylpurine-2,6-dione |
InChI | InChI=1S/C15H22N4O3/c1-4-8-18-10-16-13-12(18)14(21)19(15(22)17(13)3)9-6-5-7-11(2)20/h10H,4-9H2,1-3H3 |
InChIKey | RBQOQRRFDPXAGN-UHFFFAOYSA-N |
SMILES | CCCN1C=NC2=C1C(=O)N(C(=O)N2C)CCCCC(=O)C |