For research use only. Not for therapeutic Use.
Propiconazole（Cat No.:R013508）is a broad-spectrum systemic fungicide used to control various fungal diseases in crops such as wheat, corn, and soybeans. It belongs to the triazole class and works by inhibiting the enzyme lanosterol demethylase, essential for ergosterol synthesis, disrupting fungal cell membrane formation. Its application prevents diseases like rust, leaf spot, and powdery mildew, improving crop yield and quality. Propiconazole is known for its long-lasting effects, with low toxicity to humans and animals when used according to safety guidelines. It is available in various formulations for agricultural use.
| Catalog Number | R013508 |
| CAS Number | 60207-90-1 |
| Synonyms | 1-[[2-(2,4-Dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl]-1H-1,2,4-triazole; Bamper; Bamper 25EC; Banner Maxx; Binghuanzuo; Desmel; Dhan; Proconazole; Radar; Tilt; Wocosen; Wocosin 50TK; |
| Molecular Formula | C15H17Cl2N3O2 |
| Purity | ≥95% |
| Target | NF-κB |
| Storage | -20°C |
| IUPAC Name | 1-[[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole |
| InChI | InChI=1S/C15H17Cl2N3O2/c1-2-3-12-7-21-15(22-12,8-20-10-18-9-19-20)13-5-4-11(16)6-14(13)17/h4-6,9-10,12H,2-3,7-8H2,1H3 |
| InChIKey | STJLVHWMYQXCPB-UHFFFAOYSA-N |
| SMILES | CCCC1COC(O1)(CN2C=NC=N2)C3=C(C=C(C=C3)Cl)Cl |
