For research use only. Not for therapeutic Use.
Propio-2,2-d2-phenone is a deuterated form of propiophenone, featuring two deuterium atoms at the 2,2 positions. This high-purity compound is essential for advanced biochemical and pharmaceutical research, particularly in studying metabolic pathways, reaction mechanisms, and synthetic applications. Its stable isotope labeling ensures precise and reliable analytical results. Propio-2,2-d2-phenone is ideal for investigations involving carbonyl chemistry and ketone metabolism, providing a robust and consistent tool for high-precision scientific studies, seamlessly integrating into existing research protocols.
CAS Number | 129848-87-9 |
Synonyms | PROPIO-2,2-D2-PHENONE |
Molecular Formula | C9H10O |
Purity | ≥95% |
Storage | Desiccate at -20 ℃ |
IUPAC Name | 2,2-dideuterio-1-phenylpropan-1-one |
InChI | InChI=1S/C9H10O/c1-2-9(10)8-6-4-3-5-7-8/h3-7H,2H2,1H3/i2D2 |
InChIKey | KRIOVPPHQSLHCZ-CBTSVUPCSA-N |
SMILES | CCC(=O)C1=CC=CC=C1 |