Home
>
Isotope Labeled Compounds>Isotope Labeled Inhibitors> Propionaldehyde-13C6 2,4-Dinitrophenylhydrazone
For research use only. Not for therapeutic Use.
Propionaldehyde-13C6 2,4-Dinitrophenylhydrazone is a fully carbon-13 labeled derivative of propionaldehyde, complexed with 2,4-dinitrophenylhydrazone. This compound is used in chemical and analytical research for its enhanced precision in techniques such as NMR and mass spectrometry. The carbon-13 labeling allows for detailed tracking of the aldehyde’s behavior, reaction mechanisms, and interactions in various chemical environments. This derivative is particularly useful for studying the formation and identification of carbonyl compounds in organic synthesis and for investigating metabolic pathways involving aldehydes in biochemical research.
CAS Number | NA |
Synonyms | Propanal-13C6 2-(2,4-Dinitrophenyl)hydrazone; Propanal-13C6 (2,4-Dinitrophenyl)hydrazone; Propionaldehyde-13C6 (2,4-Dinitrophenyl)hydrazone; |
Molecular Formula | C₃¹³C₆H₁₀N₄O₄ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,4-dinitro-N-[(Z)-propylideneamino](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine |
InChI | InChI=1S/C9H10N4O4/c1-2-5-10-11-8-4-3-7(12(14)15)6-9(8)13(16)17/h3-6,11H,2H2,1H3/b10-5-/i3+1,4+1,6+1,7+1,8+1,9+1 |
InChIKey | NFQHZOZOFGDSIN-AOFAKMLJSA-N |
SMILES | CC/C=N\N[13C]1=[13C]([13CH]=[13C]([13CH]=[13CH]1)[N+](=O)[O-])[N+](=O)[O-] |