For research use only. Not for therapeutic Use.
Propionic Acid-d3 is a deuterated form of propionic acid, where three hydrogen atoms are replaced with deuterium. This labeling makes it particularly useful in research, especially in studies involving metabolic pathways, reaction mechanisms, and environmental tracing. The deuterium atoms provide a distinct isotopic signature, allowing for precise tracking and analysis using techniques such as mass spectrometry and NMR spectroscopy. Propionic Acid-d3 is often used in studies of fatty acid metabolism, microbial fermentation processes, and as a tracer in biochemical research.
CAS Number | 55577-88-3 |
Synonyms | Adofeed-d3; Antischim B-d3; Carboxyethane-d3; Ethanecarboxylic Acid-d3; Ethylformic Acid-d3; Luprosil-d3; Metacetonic Acid-d3; Methylacetic Acid-d3; MonoProp-d3; Propcorn-d3; Propkorn-d3; Prozoin-d3; Pseudoacetic Acid-d3; Toxi-Check-d3 |
Molecular Formula | C3H6O2 |
Purity | ≥95% |
Storage | Room temperature |
IUPAC Name | 3,3,3-trideuteriopropanoic acid |
InChI | InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5)/i1D3 |
InChIKey | XBDQKXXYIPTUBI-FIBGUPNXSA-N |
SMILES | CCC(=O)O |