For research use only. Not for therapeutic Use.
Propiophenone（Cat No.:R059085） is an organic compound, classified chemically as an aromatic ketone. It features a simple structure with a phenyl group attached to a propyl ketone. This compound is a colorless, oily liquid that emits a faint, sweetish odor and is commonly used as an intermediate in the synthesis of pharmaceuticals and fine chemicals. Propiophenone serves as a building block for the production of various drugs, including stimulants and anticonvulsants, by undergoing reactions like reduction, oxidation, and condensation. It is also used in the fragrance industry to create synthetic perfumes.
| Catalog Number | R059085 |
| CAS Number | 93-55-0 |
| Synonyms | 1-Phenyl-1-propanone; 3-Phenyl-3-propanone; Ethyl Phenyl Ketone; NSC 16937; Phenyl Ethyl Ketone; Propionylbenzene; |
| Molecular Formula | C9H10O |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | 1-phenylpropan-1-one |
| InChI | InChI=1S/C9H10O/c1-2-9(10)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| InChIKey | KRIOVPPHQSLHCZ-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC=CC=C1 |
