For research use only. Not for therapeutic Use.
Propyl zithiate is a sulfur-containing organophosphorus compound primarily used as a flotation agent in the mining industry. It acts as a collector for the extraction of minerals, particularly in the separation of sulfide ores like copper, lead, and zinc. Its structure, featuring a propyl group and a zithiocarbonyl functional group, enhances its ability to bind with metal ions. This compound is valued for its efficiency in improving ore recovery rates, contributing to advancements in mineral processing and industrial chemistry.
| Catalog Number | M068068 |
| CAS Number | 1000-90-4 |
| Molecular Formula | C8H14O2S4Zn |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | zinc;propan-2-yloxymethanedithioate |
| InChI | InChI=1S/2C4H8OS2.Zn/c2*1-3(2)5-4(6)7;/h2*3H,1-2H3,(H,6,7);/q;;+2/p-2 |
| InChIKey | SZNCKQHFYDCMLZ-UHFFFAOYSA-L |
| SMILES | CC(C)OC(=S)[S-].CC(C)OC(=S)[S-].[Zn+2] |
