For research use only. Not for therapeutic Use.
Propylene glycol monolaurate (Cat.No:R071328) is an emulsifier and surfactant commonly used in various industries, including food, cosmetics, and pharmaceuticals. It helps mix substances that would otherwise separate, making it valuable in products like salad dressings, creams, and ointments. Additionally, it acts as a stabilizer and thickening agent.
| Catalog Number | R071328 |
| CAS Number | 27194-74-7 |
| Synonyms | 1.2-Propanediol monolaurate, Schercemol PGML(TM), Capmul PG-12(TM) |
| Molecular Formula | C15H30O3 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 2-hydroxypropyl dodecanoate |
| InChI | InChI=1S/C15H30O3/c1-3-4-5-6-7-8-9-10-11-12-15(17)18-13-14(2)16/h14,16H,3-13H2,1-2H3 |
| InChIKey | BHIZVZJETFVJMJ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCC(=O)OCC(C)O |
