For research use only. Not for therapeutic Use.
Propyphenazone-d3（Cat No.:S000420） is a deuterated version of propyphenazone, where three hydrogen atoms are replaced with deuterium. This structural modification is intended to enhance the compound’s stability and facilitate pharmacokinetic and metabolic research. Propyphenazone is a non-opioid analgesic used to treat pain and fever. It works similarly to other nonsteroidal anti-inflammatory drugs (NSAIDs) by inhibiting the enzyme activity involved in inflammation and pain signaling pathways. The deuterated version, Propyphenazone-d3, allows for precise studies of how the drug is metabolized and eliminated in the body, providing insights into its pharmacological behavior and potential interactions.
| Catalog Number | S000420 |
| CAS Number | 162935-29-7 |
| Molecular Formula | C14H15D3N2O |
| Purity | ≥95% |
| IUPAC Name | 5-methyl-2-phenyl-4-propan-2-yl-1-(trideuteriomethyl)pyrazol-3-one |
| InChI | InChI=1S/C14H18N2O/c1-10(2)13-11(3)15(4)16(14(13)17)12-8-6-5-7-9-12/h5-10H,1-4H3/i4D3 |
| InChIKey | PXWLVJLKJGVOKE-GKOSEXJESA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)C(C)C |
