For research use only. Not for therapeutic Use.
Propyphenazone(Cat No.:I003682) is a derivative of pyrazolone that exhibits anti-inflammatory, analgesic, and antipyretic properties. It acts as a non-selective inhibitor of cyclooxygenase enzymes, thereby reducing the production of inflammatory mediators. Propyphenazone and its analogues are being investigated as prodrugs and selective cyclooxygenase-2 (COX-2) inhibitors, aiming to provide targeted anti-inflammatory effects with reduced side effects compared to traditional nonsteroidal anti-inflammatory drugs (NSAIDs).
Catalog Number | I003682 |
CAS Number | 479-92-5 |
Molecular Formula | C14H18N2O |
Purity | ≥95% |
Target | COX |
Solubility | DMSO: ≥ 2.6 mg/mL |
Storage | Room Temperature |
IUPAC Name | 1,5-dimethyl-2-phenyl-4-propan-2-ylpyrazol-3-one |
InChI | InChI=1S/C14H18N2O/c1-10(2)13-11(3)15(4)16(14(13)17)12-8-6-5-7-9-12/h5-10H,1-4H3 |
InChIKey | PXWLVJLKJGVOKE-UHFFFAOYSA-N |
SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)C(C)C |
Reference | <p style=/line-height:25px/> |