For research use only. Not for therapeutic Use.
Propyrisulfuron is a herbicide widely used in agriculture to control broadleaf weeds and grasses in various crops. Its mechanism of action involves inhibiting acetolactate synthase (ALS), an enzyme crucial for branched-chain amino acid biosynthesis in plants. Propyrisulfuron is valued for its efficacy, low application rates, and minimal environmental impact compared to other herbicides.
| Catalog Number | R071437 |
| CAS Number | 570415-88-2 |
| Synonyms | Propyrisulfuron; TH 547; 1-(2-chloro-6-propylimidazo[1,2-b]pyridazin-3-yl)sulfonyl-3-(4,6-dimethoxypyrimidin-2-yl)urea |
| Molecular Formula | C16H18ClN7O5S |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | 1-(2-chloro-6-propylimidazo[1,2-b]pyridazin-3-yl)sulfonyl-3-(4,6-dimethoxypyrimidin-2-yl)urea |
| InChI | InChI=1S/C16H18ClN7O5S/c1-4-5-9-6-7-10-18-13(17)14(24(10)22-9)30(26,27)23-16(25)21-15-19-11(28-2)8-12(20-15)29-3/h6-8H,4-5H2,1-3H3,(H2,19,20,21,23,25) |
| InChIKey | PYCINWWWERDNKE-UHFFFAOYSA-N |
| SMILES | CCCC1=NN2C(=NC(=C2S(=O)(=O)NC(=O)NC3=NC(=CC(=N3)OC)OC)Cl)C=C1 |
