For research use only. Not for therapeutic Use.
Prostaglandin E1-d4 is a deuterated form of Prostaglandin E1 (PGE1), a bioactive lipid involved in various physiological processes such as vasodilation, inflammation, and smooth muscle relaxation. In this version, four hydrogen atoms are replaced with deuterium, making it particularly useful in pharmacokinetic and metabolic studies. The deuterium labeling allows for precise tracking and analysis using mass spectrometry and NMR spectroscopy. Despite the isotopic substitution, Prostaglandin E1-d4 retains the same biological activity as the non-deuterated form, making it valuable for detailed research into PGE1’s roles and mechanisms in the body.
CAS Number | 211105-33-8 |
Synonyms | (11α,13E,15S)-11,15-Dihydroxy-9-oxoprost-13-en-1-oic Acid-d4; 3-Hydroxy-2-(3-hydroxy-1-octenyl)-5-oxo-cyclopentaneheptanoic Acid-d4; Alprostadil-d4; Alprox TD-d4; Caveject-d4; Liprostin-d4; ONO 1608-d4; PGE1-d4; Palux-d4; Prostandin-d4; Minprog-d4; |
Molecular Formula | C20H34O5 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | -20°C |
IUPAC Name | 3,3,4,4-tetradeuterio-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoic acid |
InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-17,19,21,23H,2-11,14H2,1H3,(H,24,25)/b13-12+/t15-,16+,17+,19+/m0/s1/i5D2,8D2 |
InChIKey | GMVPRGQOIOIIMI-HKEIXBCBSA-N |
SMILES | CCCCCC(C=CC1C(CC(=O)C1CCCCCCC(=O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |