PROTAC BRD4 Degrader-1（Cat No.:I017348） is a specialized molecule designed to target and induce the degradation of BRD4, a member of the BET (Bromodomain and Extra-Terminal) family, which plays a critical role in transcription regulation and is implicated in various cancers. This molecule operates on the PROTAC (Proteolysis Targeting Chimera) technology, which recruits an E3 ubiquitin ligase to tag BRD4 for degradation by the proteasome system. By specifically degrading BRD4, PROTAC BRD4 Degrader-1 offers a novel approach to disrupt cancer cell growth and survival, providing potential therapeutic benefits in oncology.
| Catalog Number | I017348 |
| CAS Number | 2133360-00-4 |
| Molecular Formula | C₄₀H₃₇N₉O₈ |
| Purity | 95% |
| IUPAC Name | 2-[2-[4-[[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methyl-2-oxo-4-phenyl-4H-quinazolin-3-yl]methyl]triazol-1-yl]ethoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide |
| InChI | InChI=1S/C40H37N9O8/c1-22-34(23(2)57-44-22)25-12-13-30-28(18-25)36(24-8-5-4-6-9-24)48(40(55)46(30)3)20-26-19-47(45-43-26)16-17-56-21-33(51)41-29-11-7-10-27-35(29)39(54)49(38(27)53)31-14-15-32(50)42-37(31)52/h4-13,18-19,31,36H,14-17,20-21H2,1-3H3,(H,41,51)(H,42,50,52) |
| InChIKey | FXNACIMQXOPNJG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CC3=C(C=C2)N(C(=O)N(C3C4=CC=CC=C4)CC5=CN(N=N5)CCOCC(=O)NC6=CC=CC7=C6C(=O)N(C7=O)C8CCC(=O)NC8=O)C |
