For research use only. Not for therapeutic Use.
PROTAC CYP1B1 Degrader-1（Cat No.:I043440）is a proteolysis-targeting chimera (PROTAC) designed to selectively degrade cytochrome P450 1B1 (CYP1B1), an enzyme involved in the metabolism of various endogenous compounds and drugs. CYP1B1 has been implicated in the development of certain cancers, as it activates procarcinogens and contributes to tumor progression. By targeting CYP1B1 for degradation through the ubiquitin-proteasome system, PROTAC CYP1B1 Degrader-1 aims to reduce its oncogenic activity. This compound is being studied for its potential therapeutic applications in cancer and other diseases where CYP1B1 plays a role in disease progression.
| CAS Number | 2411389-67-6 |
| Synonyms | 2-(2,6-dioxopiperidin-3-yl)-4-[6-[4-[4-(6,7,10-trimethoxy-4-oxobenzo[h]chromen-2-yl)phenyl]triazol-1-yl]hexoxy]isoindole-1,3-dione |
| Molecular Formula | C43H39N5O10 |
| Purity | ≥95% |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[6-[4-[4-(6,7,10-trimethoxy-4-oxobenzo[h]chromen-2-yl)phenyl]triazol-1-yl]hexoxy]isoindole-1,3-dione |
| InChI | InChI=1S/C43H39N5O10/c1-54-31-16-17-32(55-2)39-38(31)35(56-3)21-27-30(49)22-34(58-40(27)39)25-13-11-24(12-14-25)28-23-47(46-45-28)19-6-4-5-7-20-57-33-10-8-9-26-37(33)43(53)48(42(26)52)29-15-18-36(50)44-41(29)51/h8-14,16-17,21-23,29H,4-7,15,18-20H2,1-3H3,(H,44,50,51) |
| InChIKey | MRMQVUIZIOZVSD-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC3=C(C2=C(C=C1)OC)OC(=CC3=O)C4=CC=C(C=C4)C5=CN(N=N5)CCCCCCOC6=CC=CC7=C6C(=O)N(C7=O)C8CCC(=O)NC8=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
