For research use only. Not for therapeutic Use.
Protected meropenem(Cat No.:L006718), is a modified form of the antibiotic meropenem, designed for controlled release or stability purposes during chemical synthesis. The protection involves temporary modification of specific functional groups in the meropenem molecule. This modification ensures the compound’s stability during various chemical reactions while maintaining its reactivity towards desired targets. Protected meropenem is crucial in pharmaceutical research, where precise chemical modifications are essential to develop novel antibiotics or other therapeutic agents. Chemists utilize these protected forms as intermediates, removing the protecting groups at specific steps to obtain the desired active compound, aiding advancements in drug discovery.
CAS Number | 96036-02-1 |
Molecular Formula | C32H35N5O11S |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | (4-nitrophenyl)methyl (4R,5S,6S)-3-[(3S,5S)-5-(dimethylcarbamoyl)-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
InChI | InChI=1S/C32H35N5O11S/c1-17-26-25(18(2)38)30(40)35(26)27(31(41)47-15-19-5-9-21(10-6-19)36(43)44)28(17)49-23-13-24(29(39)33(3)4)34(14-23)32(42)48-16-20-7-11-22(12-8-20)37(45)46/h5-12,17-18,23-26,38H,13-16H2,1-4H3/t17-,18-,23+,24+,25-,26-/m1/s1 |
InChIKey | PJGGEFUAFDAJJT-ALUDVLAQSA-N |
SMILES | CC1C2C(C(=O)N2C(=C1SC3CC(N(C3)C(=O)OCC4=CC=C(C=C4)[N+](=O)[O-])C(=O)N(C)C)C(=O)OCC5=CC=C(C=C5)[N+](=O)[O-])C(C)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |