For research use only. Not for therapeutic Use.
Prothidathion is an organophosphate insecticide.
| Catalog Number | I035098 |
| CAS Number | 20276-83-9 |
| Synonyms | Prothidathion; |
| Molecular Formula | C10H19N2O4PS3 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | O,O-diethyl S-((5-isopropoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl) phosphorodithioate |
| InChI | InChI=1S/C10H19N2O4PS3/c1-5-14-17(18,15-6-2)19-7-12-10(13)20-9(11-12)16-8(3)4/h8H,5-7H2,1-4H3 |
| InChIKey | LQHMZSQJOYPNND-UHFFFAOYSA-N |
| SMILES | S=P(OCC)(SCN1C(SC(OC(C)C)=N1)=O)OCC |
| Reference | 1: Quest JA, Copley MP, Hamernik KL, Rinde E, Fisher B, Engler R, Burnam WL, Fenner-Crisp PA. Evaluation of the carcinogenic potential of pesticides. 2. Methidathion. Regul Toxicol Pharmacol. 1990 Oct;12(2):117-26. PubMed PMID: 2259753. |
