For research use only. Not for therapeutic Use.
PROTO-1(Cat No.:I003107)is an investigational small molecule designed to inhibit the protein-protein interactions between the oncogenic protein p53 and its negative regulator, MDM2. By disrupting this interaction, PROTO-1 stabilizes and activates the tumor suppressor p53, which is crucial in regulating cell cycle progression, apoptosis, and DNA repair. In many cancers, p53 is inactivated through binding with MDM2, leading to uncontrolled cell growth. PROTO-1 is being studied in preclinical research as a potential therapeutic agent for restoring p53 activity and treating cancers with p53-related mutations, such as breast and lung cancers.
Catalog Number | I003107 |
CAS Number | 312951-85-2 |
Molecular Formula | C17H19ClN4O2S |
Purity | ≥95% |
Solubility | 10 mM in DMSO |
Storage | Store at -20C |
IUPAC Name | 2-[(4-chlorophenyl)carbamoylamino]-6-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
InChI | InChI=1S/C17H19ClN4O2S/c1-2-22-8-7-12-13(9-22)25-16(14(12)15(19)23)21-17(24)20-11-5-3-10(18)4-6-11/h3-6H,2,7-9H2,1H3,(H2,19,23)(H2,20,21,24) |
InChIKey | QBLKUVUKIZEWAL-UHFFFAOYSA-N |
SMILES | CCN1CCC2=C(C1)SC(=C2C(=O)N)NC(=O)NC3=CC=C(C=C3)Cl |
Reference | <p style=/line-height:25px/> |