For research use only. Not for therapeutic Use.
Protokylol（Cat No.:M067007）, also known as procytox, is a chemotherapy drug belonging to the alkylating agent class. Its chemical structure consists of a cyclophosphamide derivative with antineoplastic properties. Protokylol is primarily used in the treatment of various cancers, including leukemia, lymphoma, and solid tumors. It works by interfering with the DNA synthesis process in rapidly dividing cancer cells, leading to cell death.
| Catalog Number | M067007 |
| CAS Number | 136-70-9 |
| Molecular Formula | C18H21NO5 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | -20°C |
| IUPAC Name | 4-[2-[1-(1,3-benzodioxol-5-yl)propan-2-ylamino]-1-hydroxyethyl]benzene-1,2-diol |
| InChI | InChI=1S/C18H21NO5/c1-11(6-12-2-5-17-18(7-12)24-10-23-17)19-9-16(22)13-3-4-14(20)15(21)8-13/h2-5,7-8,11,16,19-22H,6,9-10H2,1H3 |
| InChIKey | LUMAEVHDZXIGEP-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC2=C(C=C1)OCO2)NCC(C3=CC(=C(C=C3)O)O)O |
