For research use only. Not for therapeutic Use.
Protoporphyrin IX(CAT: I004059) is a chemical compound that is an intermediate in the biosynthesis of heme, an essential molecule involved in various biological processes. Protoporphyrin IX is a porphyrin derivative and serves as the precursor for the synthesis of heme, which is required for the function of hemoglobin, myoglobin, and various enzymes involved in oxygen transport and metabolism. It is also a photosensitizer and can generate reactive oxygen species upon exposure to light, making it useful in photodynamic therapy for the treatment of certain cancers and other medical conditions.
CAS Number | 553-12-8 |
Molecular Formula | C34H34N4O4 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Solubility | DMSO: ≥ 5.6 mg/mL |
Storage | Room temperature |
IUPAC Name | 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
InChI | InChI=1S/C34H34N4O4/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25/h7-8,13-16,35-36H,1-2,9-12H2,3-6H3,(H,39,40)(H,41,42) |
InChIKey | ZCFFYALKHPIRKJ-UHFFFAOYSA-N |
SMILES | CC1=C(C2=CC3=C(C(=C(N3)C=C4C(=C(C(=N4)C=C5C(=C(C(=N5)C=C1N2)C)CCC(=O)O)CCC(=O)O)C)C=C)C)C=C |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |