For research use only. Not for therapeutic Use.
PRT4165(Cat No.:I003098)is a selective and potent small molecule inhibitor of the protein kinase STK33 (serine/threonine kinase 33). STK33 has been implicated in regulating various cellular processes, including cell survival, proliferation, and apoptosis, and is often associated with cancer cell growth. By inhibiting STK33, PRT4165 has shown potential in preclinical studies to disrupt cancer cell signaling pathways, leading to reduced tumor growth and increased sensitivity to other therapies. Ongoing research is focused on understanding its efficacy, selectivity, and safety in treating cancers or other diseases linked to abnormal STK33 activity.
CAS Number | 31083-55-3 |
Synonyms | 2-(pyridin-3-ylmethylene)-1H-indene-1,3(2H)-dione |
Molecular Formula | C₁₅H₁₉NO₂ |
Purity | ≥95% |
Target | E1/E2/E3 Enzyme |
Solubility | 10 mM in DMSO |
Storage | Store at +4C |
IUPAC Name | 2-(pyridin-3-ylmethylidene)indene-1,3-dione |
InChI | InChI=1S/C15H9NO2/c17-14-11-5-1-2-6-12(11)15(18)13(14)8-10-4-3-7-16-9-10/h1-9H |
InChIKey | OMHZFEWYVFWVLI-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=O)C(=CC3=CN=CC=C3)C2=O |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |